C33H28N4O8 — CID 4604297
[2-[[[3-[2-[[2-(4-methoxybenzoyl)oxyphenyl]methylidene]hydrazinyl]-3-oxopropanoyl]hydrazinylidene]methyl]phenyl] 4-methoxybenzoate (PubChem CID 4604297) has the molecular formula C33H28N4O8 and a molecular weight of 608.61 g/mol. Its IUPAC name is [2-[[[3-[2-[[2-(4-methoxybenzoyl)oxyphenyl]methylidene]hydrazinyl]-3-oxopropanoyl]hydrazinylidene]methyl]phenyl] 4-methoxybenzoate.
| Compound Name | [2-[[[3-[2-[[2-(4-methoxybenzoyl)oxyphenyl]methylidene]hydrazinyl]-3-oxopropanoyl]hydrazinylidene]methyl]phenyl] 4-methoxybenzoate |
|---|---|
| PubChem CID | 4604297 |
| Molecular Formula | C33H28N4O8 |
| Molecular Weight | 608.61 g/mol |
| Exact Mass | 608.19 |
| IUPAC Name | [2-[[[3-[2-[[2-(4-methoxybenzoyl)oxyphenyl]methylidene]hydrazinyl]-3-oxopropanoyl]hydrazinylidene]methyl]phenyl] 4-methoxybenzoate |
| SMILES | COc1ccc(C(=O)Oc2ccccc2C=NNC(=O)CC(=O)NN=Cc2ccccc2OC(=O)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C33H28N4O8/c1-42-26-15-11-22(12-16-26)32(40)44-28-9-5-3-7-24(28)20-34-36-30(38)19-31(39)37-35-21-25-8-4-6-10-29(25)45-33(41)23-13-17-27(43-2)18-14-23/h3-18,20-21H,19H2,1-2H3,(H,36,38)(H,37,39) |
| InChIKey | ITQYQSWCTGIONZ-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 153.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.61 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|