C36H34N4O6 — CID 3282649
[2-[[[8-[2-[(2-benzoyloxyphenyl)methylidene]hydrazinyl]-8-oxooctanoyl]hydrazinylidene]methyl]phenyl] benzoate (PubChem CID 3282649) has the molecular formula C36H34N4O6 and a molecular weight of 618.69 g/mol. Its IUPAC name is [2-[[[8-[2-[(2-benzoyloxyphenyl)methylidene]hydrazinyl]-8-oxooctanoyl]hydrazinylidene]methyl]phenyl] benzoate.
| Compound Name | [2-[[[8-[2-[(2-benzoyloxyphenyl)methylidene]hydrazinyl]-8-oxooctanoyl]hydrazinylidene]methyl]phenyl] benzoate |
|---|---|
| PubChem CID | 3282649 |
| Molecular Formula | C36H34N4O6 |
| Molecular Weight | 618.69 g/mol |
| Exact Mass | 618.25 |
| IUPAC Name | [2-[[[8-[2-[(2-benzoyloxyphenyl)methylidene]hydrazinyl]-8-oxooctanoyl]hydrazinylidene]methyl]phenyl] benzoate |
| SMILES | O=C(CCCCCCC(=O)NN=Cc1ccccc1OC(=O)c1ccccc1)NN=Cc1ccccc1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C36H34N4O6/c41-33(39-37-25-29-19-11-13-21-31(29)45-35(43)27-15-5-3-6-16-27)23-9-1-2-10-24-34(42)40-38-26-30-20-12-14-22-32(30)46-36(44)28-17-7-4-8-18-28/h3-8,11-22,25-26H,1-2,9-10,23-24H2,(H,39,41)(H,40,42) |
| InChIKey | ADZNFWFYOGWXCZ-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 135.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.69 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|