C21H24ClN3O4 — CID 129185181
[2-[(E)-[[2-(4-methylmorpholin-4-ium-4-yl)acetyl]hydrazinylidene]methyl]phenyl] benzoate chloride (PubChem CID 129185181) has the molecular formula C21H24ClN3O4 and a molecular weight of 417.89 g/mol. Its IUPAC name is [2-[(E)-[[2-(4-methylmorpholin-4-ium-4-yl)acetyl]hydrazinylidene]methyl]phenyl] benzoate chloride.
| Compound Name | [2-[(E)-[[2-(4-methylmorpholin-4-ium-4-yl)acetyl]hydrazinylidene]methyl]phenyl] benzoate chloride |
|---|---|
| PubChem CID | 129185181 |
| Molecular Formula | C21H24ClN3O4 |
| Molecular Weight | 417.89 g/mol |
| Exact Mass | 417.15 |
| IUPAC Name | [2-[(E)-[[2-(4-methylmorpholin-4-ium-4-yl)acetyl]hydrazinylidene]methyl]phenyl] benzoate chloride |
| SMILES | C[N+]1(CC(=O)N/N=C/c2ccccc2OC(=O)c2ccccc2)CCOCC1.[Cl-] |
| InChI | InChI=1S/C21H23N3O4.ClH/c1-24(11-13-27-14-12-24)16-20(25)23-22-15-18-9-5-6-10-19(18)28-21(26)17-7-3-2-4-8-17;/h2-10,15H,11-14,16H2,1H3;1H/b22-15+; |
| InChIKey | JSZQZDBOOFGSRQ-WXXHTBLMSA-N |
| XLogP | -1.16 |
| TPSA | 76.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.89 |
| LogP ≤ 5 | -1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|