C32H24Br2N4O6 — CID 125115444
[2-[[[4-[(2E)-2-[(2-benzoyloxy-5-bromophenyl)methylidene]hydrazinyl]-4-oxobutanoyl]hydrazinylidene]methyl]-4-bromophenyl] benzoate (PubChem CID 125115444) has the molecular formula C32H24Br2N4O6 and a molecular weight of 720.37 g/mol. Its IUPAC name is [2-[[[4-[(2E)-2-[(2-benzoyloxy-5-bromophenyl)methylidene]hydrazinyl]-4-oxobutanoyl]hydrazinylidene]methyl]-4-bromophenyl] benzoate.
| Compound Name | [2-[[[4-[(2E)-2-[(2-benzoyloxy-5-bromophenyl)methylidene]hydrazinyl]-4-oxobutanoyl]hydrazinylidene]methyl]-4-bromophenyl] benzoate |
|---|---|
| PubChem CID | 125115444 |
| Molecular Formula | C32H24Br2N4O6 |
| Molecular Weight | 720.37 g/mol |
| Exact Mass | 718.01 |
| IUPAC Name | [2-[[[4-[(2E)-2-[(2-benzoyloxy-5-bromophenyl)methylidene]hydrazinyl]-4-oxobutanoyl]hydrazinylidene]methyl]-4-bromophenyl] benzoate |
| SMILES | O=C(CCC(=O)N/N=C/c1cc(Br)ccc1OC(=O)c1ccccc1)NN=Cc1cc(Br)ccc1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C32H24Br2N4O6/c33-25-11-13-27(43-31(41)21-7-3-1-4-8-21)23(17-25)19-35-37-29(39)15-16-30(40)38-36-20-24-18-26(34)12-14-28(24)44-32(42)22-9-5-2-6-10-22/h1-14,17-20H,15-16H2,(H,37,39)(H,38,40)/b35-19+,36-20? |
| InChIKey | SAKKTJRKZSMFEF-KJVLLSDVSA-N |
| XLogP | 6.03 |
| TPSA | 135.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 720.37 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|