C21H15BrN2O3 — CID 6146613
[2-[(Z)-(benzoylhydrazinylidene)methyl]-4-bromophenyl] benzoate (PubChem CID 6146613) has the molecular formula C21H15BrN2O3 and a molecular weight of 423.27 g/mol. Its IUPAC name is [2-[(Z)-(benzoylhydrazinylidene)methyl]-4-bromophenyl] benzoate.
| Compound Name | [2-[(Z)-(benzoylhydrazinylidene)methyl]-4-bromophenyl] benzoate |
|---|---|
| PubChem CID | 6146613 |
| Molecular Formula | C21H15BrN2O3 |
| Molecular Weight | 423.27 g/mol |
| Exact Mass | 422.03 |
| IUPAC Name | [2-[(Z)-(benzoylhydrazinylidene)methyl]-4-bromophenyl] benzoate |
| SMILES | O=C(N/N=C\c1cc(Br)ccc1OC(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H15BrN2O3/c22-18-11-12-19(27-21(26)16-9-5-2-6-10-16)17(13-18)14-23-24-20(25)15-7-3-1-4-8-15/h1-14H,(H,24,25)/b23-14- |
| InChIKey | ZUOKIWYJUCPHHJ-UCQKPKSFSA-N |
| XLogP | 4.43 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.27 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|