C28H22BrN3O5S — CID 4689967
[4-bromo-2-[[[4-[(4-methylphenyl)sulfonylamino]benzoyl]hydrazinylidene]methyl]phenyl] benzoate (PubChem CID 4689967) has the molecular formula C28H22BrN3O5S and a molecular weight of 592.47 g/mol. Its IUPAC name is [4-bromo-2-[[[4-[(4-methylphenyl)sulfonylamino]benzoyl]hydrazinylidene]methyl]phenyl] benzoate.
| Compound Name | [4-bromo-2-[[[4-[(4-methylphenyl)sulfonylamino]benzoyl]hydrazinylidene]methyl]phenyl] benzoate |
|---|---|
| PubChem CID | 4689967 |
| Molecular Formula | C28H22BrN3O5S |
| Molecular Weight | 592.47 g/mol |
| Exact Mass | 591.05 |
| IUPAC Name | [4-bromo-2-[[[4-[(4-methylphenyl)sulfonylamino]benzoyl]hydrazinylidene]methyl]phenyl] benzoate |
| SMILES | Cc1ccc(S(=O)(=O)Nc2ccc(C(=O)NN=Cc3cc(Br)ccc3OC(=O)c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C28H22BrN3O5S/c1-19-7-14-25(15-8-19)38(35,36)32-24-12-9-20(10-13-24)27(33)31-30-18-22-17-23(29)11-16-26(22)37-28(34)21-5-3-2-4-6-21/h2-18,32H,1H3,(H,31,33) |
| InChIKey | WADNYLDIHGWFMF-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 113.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.47 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|