C23H20BrN3O4S — CID 4287720
4-(benzenesulfonamido)-N-[(5-bromo-2-prop-2-enoxyphenyl)methylideneamino]benzamide (PubChem CID 4287720) has the molecular formula C23H20BrN3O4S and a molecular weight of 514.40 g/mol. Its IUPAC name is 4-(benzenesulfonamido)-N-[(5-bromo-2-prop-2-enoxyphenyl)methylideneamino]benzamide.
| Compound Name | 4-(benzenesulfonamido)-N-[(5-bromo-2-prop-2-enoxyphenyl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 4287720 |
| Molecular Formula | C23H20BrN3O4S |
| Molecular Weight | 514.40 g/mol |
| Exact Mass | 513.04 |
| IUPAC Name | 4-(benzenesulfonamido)-N-[(5-bromo-2-prop-2-enoxyphenyl)methylideneamino]benzamide |
| SMILES | C=CCOc1ccc(Br)cc1C=NNC(=O)c1ccc(NS(=O)(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C23H20BrN3O4S/c1-2-14-31-22-13-10-19(24)15-18(22)16-25-26-23(28)17-8-11-20(12-9-17)27-32(29,30)21-6-4-3-5-7-21/h2-13,15-16,27H,1,14H2,(H,26,28) |
| InChIKey | APHQVKHNFVLEEB-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 96.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.40 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|