C20H16BrN3O4S — CID 136867354
4-(benzenesulfonamido)-N-[(Z)-(5-bromo-2-hydroxyphenyl)methylideneamino]benzamide (PubChem CID 136867354) has the molecular formula C20H16BrN3O4S and a molecular weight of 474.34 g/mol. Its IUPAC name is 4-(benzenesulfonamido)-N-[(Z)-(5-bromo-2-hydroxyphenyl)methylideneamino]benzamide.
| Compound Name | 4-(benzenesulfonamido)-N-[(Z)-(5-bromo-2-hydroxyphenyl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 136867354 |
| Molecular Formula | C20H16BrN3O4S |
| Molecular Weight | 474.34 g/mol |
| Exact Mass | 473.00 |
| IUPAC Name | 4-(benzenesulfonamido)-N-[(Z)-(5-bromo-2-hydroxyphenyl)methylideneamino]benzamide |
| SMILES | O=C(N/N=C\c1cc(Br)ccc1O)c1ccc(NS(=O)(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C20H16BrN3O4S/c21-16-8-11-19(25)15(12-16)13-22-23-20(26)14-6-9-17(10-7-14)24-29(27,28)18-4-2-1-3-5-18/h1-13,24-25H,(H,23,26)/b22-13- |
| InChIKey | DSYLEWJZEBYZCL-XKZIYDEJSA-N |
| XLogP | 3.72 |
| TPSA | 107.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.34 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|