C21H19N3O5S — CID 135606019
4-(benzenesulfonamido)-N-[(E)-(2-hydroxy-5-methoxyphenyl)methylideneamino]benzamide (PubChem CID 135606019) has the molecular formula C21H19N3O5S and a molecular weight of 425.47 g/mol. Its IUPAC name is 4-(benzenesulfonamido)-N-[(E)-(2-hydroxy-5-methoxyphenyl)methylideneamino]benzamide.
| Compound Name | 4-(benzenesulfonamido)-N-[(E)-(2-hydroxy-5-methoxyphenyl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 135606019 |
| Molecular Formula | C21H19N3O5S |
| Molecular Weight | 425.47 g/mol |
| Exact Mass | 425.10 |
| IUPAC Name | 4-(benzenesulfonamido)-N-[(E)-(2-hydroxy-5-methoxyphenyl)methylideneamino]benzamide |
| SMILES | COc1ccc(O)c(/C=N/NC(=O)c2ccc(NS(=O)(=O)c3ccccc3)cc2)c1 |
| InChI | InChI=1S/C21H19N3O5S/c1-29-18-11-12-20(25)16(13-18)14-22-23-21(26)15-7-9-17(10-8-15)24-30(27,28)19-5-3-2-4-6-19/h2-14,24-25H,1H3,(H,23,26)/b22-14+ |
| InChIKey | PVPYWTZPOHTBDQ-HYARGMPZSA-N |
| XLogP | 2.97 |
| TPSA | 117.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.47 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|