C20H16ClN3O3S — CID 6114827
4-(benzenesulfonamido)-N-[(Z)-(2-chlorophenyl)methylideneamino]benzamide (PubChem CID 6114827) has the molecular formula C20H16ClN3O3S and a molecular weight of 413.89 g/mol. Its IUPAC name is 4-(benzenesulfonamido)-N-[(Z)-(2-chlorophenyl)methylideneamino]benzamide.
| Compound Name | 4-(benzenesulfonamido)-N-[(Z)-(2-chlorophenyl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 6114827 |
| Molecular Formula | C20H16ClN3O3S |
| Molecular Weight | 413.89 g/mol |
| Exact Mass | 413.06 |
| IUPAC Name | 4-(benzenesulfonamido)-N-[(Z)-(2-chlorophenyl)methylideneamino]benzamide |
| SMILES | O=C(N/N=C\c1ccccc1Cl)c1ccc(NS(=O)(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C20H16ClN3O3S/c21-19-9-5-4-6-16(19)14-22-23-20(25)15-10-12-17(13-11-15)24-28(26,27)18-7-2-1-3-8-18/h1-14,24H,(H,23,25)/b22-14- |
| InChIKey | YUXUGOOMUVAKGZ-HMAPJEAMSA-N |
| XLogP | 3.90 |
| TPSA | 87.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.89 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|