C20H15ClFN3O3S — CID 2332623
3-[(4-chlorophenyl)sulfamoyl]-N-[(2-fluorophenyl)methylideneamino]benzamide (PubChem CID 2332623) has the molecular formula C20H15ClFN3O3S and a molecular weight of 431.88 g/mol. Its IUPAC name is 3-[(4-chlorophenyl)sulfamoyl]-N-[(2-fluorophenyl)methylideneamino]benzamide.
| Compound Name | 3-[(4-chlorophenyl)sulfamoyl]-N-[(2-fluorophenyl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 2332623 |
| Molecular Formula | C20H15ClFN3O3S |
| Molecular Weight | 431.88 g/mol |
| Exact Mass | 431.05 |
| IUPAC Name | 3-[(4-chlorophenyl)sulfamoyl]-N-[(2-fluorophenyl)methylideneamino]benzamide |
| SMILES | O=C(NN=Cc1ccccc1F)c1cccc(S(=O)(=O)Nc2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C20H15ClFN3O3S/c21-16-8-10-17(11-9-16)25-29(27,28)18-6-3-5-14(12-18)20(26)24-23-13-15-4-1-2-7-19(15)22/h1-13,25H,(H,24,26) |
| InChIKey | UFIGWYMYMCDCPU-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 87.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.88 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|