C21H15ClFN3O4S — CID 167830911
3-[(4-chlorophenyl)sulfamoyl]-N-[(E)-(6-fluoro-1-benzofuran-3-ylidene)amino]benzamide (PubChem CID 167830911) has the molecular formula C21H15ClFN3O4S and a molecular weight of 459.89 g/mol. Its IUPAC name is 3-[(4-chlorophenyl)sulfamoyl]-N-[(E)-(6-fluoro-1-benzofuran-3-ylidene)amino]benzamide.
| Compound Name | 3-[(4-chlorophenyl)sulfamoyl]-N-[(E)-(6-fluoro-1-benzofuran-3-ylidene)amino]benzamide |
|---|---|
| PubChem CID | 167830911 |
| Molecular Formula | C21H15ClFN3O4S |
| Molecular Weight | 459.89 g/mol |
| Exact Mass | 459.05 |
| IUPAC Name | 3-[(4-chlorophenyl)sulfamoyl]-N-[(E)-(6-fluoro-1-benzofuran-3-ylidene)amino]benzamide |
| SMILES | O=C(N/N=C1/COc2cc(F)ccc21)c1cccc(S(=O)(=O)Nc2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C21H15ClFN3O4S/c22-14-4-7-16(8-5-14)26-31(28,29)17-3-1-2-13(10-17)21(27)25-24-19-12-30-20-11-15(23)6-9-18(19)20/h1-11,26H,12H2,(H,25,27)/b24-19- |
| InChIKey | ZYEOJCPLVWMWBQ-CLCOLTQESA-N |
| XLogP | 3.81 |
| TPSA | 96.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.89 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|