C19H13Cl3N2O3S — CID 2308611
3-[(4-chlorophenyl)sulfamoyl]-N-(2,6-dichlorophenyl)benzamide (PubChem CID 2308611) has the molecular formula C19H13Cl3N2O3S and a molecular weight of 455.75 g/mol. Its IUPAC name is 3-[(4-chlorophenyl)sulfamoyl]-N-(2,6-dichlorophenyl)benzamide.
| Compound Name | 3-[(4-chlorophenyl)sulfamoyl]-N-(2,6-dichlorophenyl)benzamide |
|---|---|
| PubChem CID | 2308611 |
| Molecular Formula | C19H13Cl3N2O3S |
| Molecular Weight | 455.75 g/mol |
| Exact Mass | 453.97 |
| IUPAC Name | 3-[(4-chlorophenyl)sulfamoyl]-N-(2,6-dichlorophenyl)benzamide |
| SMILES | O=C(Nc1c(Cl)cccc1Cl)c1cccc(S(=O)(=O)Nc2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C19H13Cl3N2O3S/c20-13-7-9-14(10-8-13)24-28(26,27)15-4-1-3-12(11-15)19(25)23-18-16(21)5-2-6-17(18)22/h1-11,24H,(H,23,25) |
| InChIKey | BKQUVVPVIOTRKH-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.75 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |