C18H20ClN3O4S — CID 9299728
3-[(4-chlorophenyl)sulfamoyl]-N-[2-oxo-2-(propan-2-ylamino)ethyl]benzamide (PubChem CID 9299728) has the molecular formula C18H20ClN3O4S and a molecular weight of 409.90 g/mol. Its IUPAC name is 3-[(4-chlorophenyl)sulfamoyl]-N-[2-oxo-2-(propan-2-ylamino)ethyl]benzamide.
| Compound Name | 3-[(4-chlorophenyl)sulfamoyl]-N-[2-oxo-2-(propan-2-ylamino)ethyl]benzamide |
|---|---|
| PubChem CID | 9299728 |
| Molecular Formula | C18H20ClN3O4S |
| Molecular Weight | 409.90 g/mol |
| Exact Mass | 409.09 |
| IUPAC Name | 3-[(4-chlorophenyl)sulfamoyl]-N-[2-oxo-2-(propan-2-ylamino)ethyl]benzamide |
| SMILES | CC(C)NC(=O)CNC(=O)c1cccc(S(=O)(=O)Nc2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C18H20ClN3O4S/c1-12(2)21-17(23)11-20-18(24)13-4-3-5-16(10-13)27(25,26)22-15-8-6-14(19)7-9-15/h3-10,12,22H,11H2,1-2H3,(H,20,24)(H,21,23) |
| InChIKey | BGKOWSDCZACJSR-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.90 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |