C21H15ClF3N3O3S — CID 2332306
3-[(4-chlorophenyl)sulfamoyl]-N-[[2-(trifluoromethyl)phenyl]methylideneamino]benzamide (PubChem CID 2332306) has the molecular formula C21H15ClF3N3O3S and a molecular weight of 481.88 g/mol. Its IUPAC name is 3-[(4-chlorophenyl)sulfamoyl]-N-[[2-(trifluoromethyl)phenyl]methylideneamino]benzamide.
| Compound Name | 3-[(4-chlorophenyl)sulfamoyl]-N-[[2-(trifluoromethyl)phenyl]methylideneamino]benzamide |
|---|---|
| PubChem CID | 2332306 |
| Molecular Formula | C21H15ClF3N3O3S |
| Molecular Weight | 481.88 g/mol |
| Exact Mass | 481.05 |
| IUPAC Name | 3-[(4-chlorophenyl)sulfamoyl]-N-[[2-(trifluoromethyl)phenyl]methylideneamino]benzamide |
| SMILES | O=C(NN=Cc1ccccc1C(F)(F)F)c1cccc(S(=O)(=O)Nc2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C21H15ClF3N3O3S/c22-16-8-10-17(11-9-16)28-32(30,31)18-6-3-5-14(12-18)20(29)27-26-13-15-4-1-2-7-19(15)21(23,24)25/h1-13,28H,(H,27,29) |
| InChIKey | JYKGQTOSMZHTNM-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 87.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.88 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|