C24H21ClN4O3S — CID 135715970
3-[(4-chlorophenyl)sulfamoyl]-N-[(E)-(7-ethyl-1H-indol-3-yl)methylideneamino]benzamide (PubChem CID 135715970) has the molecular formula C24H21ClN4O3S and a molecular weight of 480.98 g/mol. Its IUPAC name is 3-[(4-chlorophenyl)sulfamoyl]-N-[(E)-(7-ethyl-1H-indol-3-yl)methylideneamino]benzamide.
| Compound Name | 3-[(4-chlorophenyl)sulfamoyl]-N-[(E)-(7-ethyl-1H-indol-3-yl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 135715970 |
| Molecular Formula | C24H21ClN4O3S |
| Molecular Weight | 480.98 g/mol |
| Exact Mass | 480.10 |
| IUPAC Name | 3-[(4-chlorophenyl)sulfamoyl]-N-[(E)-(7-ethyl-1H-indol-3-yl)methylideneamino]benzamide |
| SMILES | CCc1cccc2c(/C=N/NC(=O)c3cccc(S(=O)(=O)Nc4ccc(Cl)cc4)c3)c[nH]c12 |
| InChI | InChI=1S/C24H21ClN4O3S/c1-2-16-5-4-8-22-18(14-26-23(16)22)15-27-28-24(30)17-6-3-7-21(13-17)33(31,32)29-20-11-9-19(25)10-12-20/h3-15,26,29H,2H2,1H3,(H,28,30)/b27-15+ |
| InChIKey | OCGWYFZHJKRRNG-JFLMPSFJSA-N |
| XLogP | 4.95 |
| TPSA | 103.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.98 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|