C23H20ClN5O4S — CID 135684470
N-(4-chlorophenyl)-2-[(2E)-2-[(7-ethyl-1H-indol-3-yl)methylidene]hydrazinyl]-5-nitrobenzenesulfonamide (PubChem CID 135684470) has the molecular formula C23H20ClN5O4S and a molecular weight of 497.96 g/mol. Its IUPAC name is N-(4-chlorophenyl)-2-[(2E)-2-[(7-ethyl-1H-indol-3-yl)methylidene]hydrazinyl]-5-nitrobenzenesulfonamide.
| Compound Name | N-(4-chlorophenyl)-2-[(2E)-2-[(7-ethyl-1H-indol-3-yl)methylidene]hydrazinyl]-5-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 135684470 |
| Molecular Formula | C23H20ClN5O4S |
| Molecular Weight | 497.96 g/mol |
| Exact Mass | 497.09 |
| IUPAC Name | N-(4-chlorophenyl)-2-[(2E)-2-[(7-ethyl-1H-indol-3-yl)methylidene]hydrazinyl]-5-nitrobenzenesulfonamide |
| SMILES | CCc1cccc2c(/C=N/Nc3ccc([N+](=O)[O-])cc3S(=O)(=O)Nc3ccc(Cl)cc3)c[nH]c12 |
| InChI | InChI=1S/C23H20ClN5O4S/c1-2-15-4-3-5-20-16(13-25-23(15)20)14-26-27-21-11-10-19(29(30)31)12-22(21)34(32,33)28-18-8-6-17(24)7-9-18/h3-14,25,27-28H,2H2,1H3/b26-14+ |
| InChIKey | JMTNUDPKQILMTD-VULFUBBASA-N |
| XLogP | 5.54 |
| TPSA | 129.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.96 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|