C19H15ClN4O5S — CID 4038495
N-(4-chlorophenyl)-2-[2-[(4-hydroxyphenyl)methylidene]hydrazinyl]-5-nitrobenzenesulfonamide (PubChem CID 4038495) has the molecular formula C19H15ClN4O5S and a molecular weight of 446.87 g/mol. Its IUPAC name is N-(4-chlorophenyl)-2-[2-[(4-hydroxyphenyl)methylidene]hydrazinyl]-5-nitrobenzenesulfonamide.
| Compound Name | N-(4-chlorophenyl)-2-[2-[(4-hydroxyphenyl)methylidene]hydrazinyl]-5-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 4038495 |
| Molecular Formula | C19H15ClN4O5S |
| Molecular Weight | 446.87 g/mol |
| Exact Mass | 446.05 |
| IUPAC Name | N-(4-chlorophenyl)-2-[2-[(4-hydroxyphenyl)methylidene]hydrazinyl]-5-nitrobenzenesulfonamide |
| SMILES | O=[N+]([O-])c1ccc(NN=Cc2ccc(O)cc2)c(S(=O)(=O)Nc2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C19H15ClN4O5S/c20-14-3-5-15(6-4-14)23-30(28,29)19-11-16(24(26)27)7-10-18(19)22-21-12-13-1-8-17(25)9-2-13/h1-12,22-23,25H |
| InChIKey | BHGKDHXYBLBOGQ-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 133.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.87 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|