C20H14ClF3N4O4S — CID 4289147
N-(4-chlorophenyl)-5-nitro-2-[2-[[4-(trifluoromethyl)phenyl]methylidene]hydrazinyl]benzenesulfonamide (PubChem CID 4289147) has the molecular formula C20H14ClF3N4O4S and a molecular weight of 498.87 g/mol. Its IUPAC name is N-(4-chlorophenyl)-5-nitro-2-[2-[[4-(trifluoromethyl)phenyl]methylidene]hydrazinyl]benzenesulfonamide.
| Compound Name | N-(4-chlorophenyl)-5-nitro-2-[2-[[4-(trifluoromethyl)phenyl]methylidene]hydrazinyl]benzenesulfonamide |
|---|---|
| PubChem CID | 4289147 |
| Molecular Formula | C20H14ClF3N4O4S |
| Molecular Weight | 498.87 g/mol |
| Exact Mass | 498.04 |
| IUPAC Name | N-(4-chlorophenyl)-5-nitro-2-[2-[[4-(trifluoromethyl)phenyl]methylidene]hydrazinyl]benzenesulfonamide |
| SMILES | O=[N+]([O-])c1ccc(NN=Cc2ccc(C(F)(F)F)cc2)c(S(=O)(=O)Nc2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C20H14ClF3N4O4S/c21-15-5-7-16(8-6-15)27-33(31,32)19-11-17(28(29)30)9-10-18(19)26-25-12-13-1-3-14(4-2-13)20(22,23)24/h1-12,26-27H |
| InChIKey | PCJAOIVVCJBWAC-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 113.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.87 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|