C19H13Cl2FN4O4S — CID 6082903
2-[(2Z)-2-[(2-chloro-6-fluorophenyl)methylidene]hydrazinyl]-N-(2-chlorophenyl)-5-nitrobenzenesulfonamide (PubChem CID 6082903) has the molecular formula C19H13Cl2FN4O4S and a molecular weight of 483.31 g/mol. Its IUPAC name is 2-[(2Z)-2-[(2-chloro-6-fluorophenyl)methylidene]hydrazinyl]-N-(2-chlorophenyl)-5-nitrobenzenesulfonamide.
| Compound Name | 2-[(2Z)-2-[(2-chloro-6-fluorophenyl)methylidene]hydrazinyl]-N-(2-chlorophenyl)-5-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 6082903 |
| Molecular Formula | C19H13Cl2FN4O4S |
| Molecular Weight | 483.31 g/mol |
| Exact Mass | 482.00 |
| IUPAC Name | 2-[(2Z)-2-[(2-chloro-6-fluorophenyl)methylidene]hydrazinyl]-N-(2-chlorophenyl)-5-nitrobenzenesulfonamide |
| SMILES | O=[N+]([O-])c1ccc(N/N=C\c2c(F)cccc2Cl)c(S(=O)(=O)Nc2ccccc2Cl)c1 |
| InChI | InChI=1S/C19H13Cl2FN4O4S/c20-14-5-3-6-16(22)13(14)11-23-24-18-9-8-12(26(27)28)10-19(18)31(29,30)25-17-7-2-1-4-15(17)21/h1-11,24-25H/b23-11- |
| InChIKey | UOMDKBRFRQBWAV-KSEXSDGBSA-N |
| XLogP | 5.29 |
| TPSA | 113.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.31 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|