C21H18Cl2N4O4S — CID 3349843
2-[2-[(2,6-dichlorophenyl)methylidene]hydrazinyl]-N-(2,4-dimethylphenyl)-5-nitrobenzenesulfonamide (PubChem CID 3349843) has the molecular formula C21H18Cl2N4O4S and a molecular weight of 493.37 g/mol. Its IUPAC name is 2-[2-[(2,6-dichlorophenyl)methylidene]hydrazinyl]-N-(2,4-dimethylphenyl)-5-nitrobenzenesulfonamide.
| Compound Name | 2-[2-[(2,6-dichlorophenyl)methylidene]hydrazinyl]-N-(2,4-dimethylphenyl)-5-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 3349843 |
| Molecular Formula | C21H18Cl2N4O4S |
| Molecular Weight | 493.37 g/mol |
| Exact Mass | 492.04 |
| IUPAC Name | 2-[2-[(2,6-dichlorophenyl)methylidene]hydrazinyl]-N-(2,4-dimethylphenyl)-5-nitrobenzenesulfonamide |
| SMILES | Cc1ccc(NS(=O)(=O)c2cc([N+](=O)[O-])ccc2NN=Cc2c(Cl)cccc2Cl)c(C)c1 |
| InChI | InChI=1S/C21H18Cl2N4O4S/c1-13-6-8-19(14(2)10-13)26-32(30,31)21-11-15(27(28)29)7-9-20(21)25-24-12-16-17(22)4-3-5-18(16)23/h3-12,25-26H,1-2H3 |
| InChIKey | UGUJOVNNVVDNFB-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 113.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.37 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|