C20H14ClFN4O6S — CID 4023058
2-[[2-[2-[(2-chloro-6-fluorophenyl)methylidene]hydrazinyl]-5-nitrophenyl]sulfonylamino]benzoic acid (PubChem CID 4023058) has the molecular formula C20H14ClFN4O6S and a molecular weight of 492.87 g/mol. Its IUPAC name is 2-[[2-[2-[(2-chloro-6-fluorophenyl)methylidene]hydrazinyl]-5-nitrophenyl]sulfonylamino]benzoic acid.
| Compound Name | 2-[[2-[2-[(2-chloro-6-fluorophenyl)methylidene]hydrazinyl]-5-nitrophenyl]sulfonylamino]benzoic acid |
|---|---|
| PubChem CID | 4023058 |
| Molecular Formula | C20H14ClFN4O6S |
| Molecular Weight | 492.87 g/mol |
| Exact Mass | 492.03 |
| IUPAC Name | 2-[[2-[2-[(2-chloro-6-fluorophenyl)methylidene]hydrazinyl]-5-nitrophenyl]sulfonylamino]benzoic acid |
| SMILES | O=C(O)c1ccccc1NS(=O)(=O)c1cc([N+](=O)[O-])ccc1NN=Cc1c(F)cccc1Cl |
| InChI | InChI=1S/C20H14ClFN4O6S/c21-15-5-3-6-16(22)14(15)11-23-24-18-9-8-12(26(29)30)10-19(18)33(31,32)25-17-7-2-1-4-13(17)20(27)28/h1-11,24-25H,(H,27,28) |
| InChIKey | DLDKZGAGLYVURO-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 151.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.87 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|