C19H15N5O6S — CID 3376260
2-[[5-nitro-2-[2-(pyridin-2-ylmethylidene)hydrazinyl]phenyl]sulfonylamino]benzoic acid (PubChem CID 3376260) has the molecular formula C19H15N5O6S and a molecular weight of 441.43 g/mol. Its IUPAC name is 2-[[5-nitro-2-[2-(pyridin-2-ylmethylidene)hydrazinyl]phenyl]sulfonylamino]benzoic acid.
| Compound Name | 2-[[5-nitro-2-[2-(pyridin-2-ylmethylidene)hydrazinyl]phenyl]sulfonylamino]benzoic acid |
|---|---|
| PubChem CID | 3376260 |
| Molecular Formula | C19H15N5O6S |
| Molecular Weight | 441.43 g/mol |
| Exact Mass | 441.07 |
| IUPAC Name | 2-[[5-nitro-2-[2-(pyridin-2-ylmethylidene)hydrazinyl]phenyl]sulfonylamino]benzoic acid |
| SMILES | O=C(O)c1ccccc1NS(=O)(=O)c1cc([N+](=O)[O-])ccc1NN=Cc1ccccn1 |
| InChI | InChI=1S/C19H15N5O6S/c25-19(26)15-6-1-2-7-16(15)23-31(29,30)18-11-14(24(27)28)8-9-17(18)22-21-12-13-5-3-4-10-20-13/h1-12,22-23H,(H,25,26) |
| InChIKey | USLBTUWZWAMFSR-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 163.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.43 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|