C22H18N4O8S — CID 6535450
2-[[2-[(2Z)-2-[(4-methoxycarbonylphenyl)methylidene]hydrazinyl]-5-nitrophenyl]sulfonylamino]benzoic acid (PubChem CID 6535450) has the molecular formula C22H18N4O8S and a molecular weight of 498.47 g/mol. Its IUPAC name is 2-[[2-[(2Z)-2-[(4-methoxycarbonylphenyl)methylidene]hydrazinyl]-5-nitrophenyl]sulfonylamino]benzoic acid.
| Compound Name | 2-[[2-[(2Z)-2-[(4-methoxycarbonylphenyl)methylidene]hydrazinyl]-5-nitrophenyl]sulfonylamino]benzoic acid |
|---|---|
| PubChem CID | 6535450 |
| Molecular Formula | C22H18N4O8S |
| Molecular Weight | 498.47 g/mol |
| Exact Mass | 498.08 |
| IUPAC Name | 2-[[2-[(2Z)-2-[(4-methoxycarbonylphenyl)methylidene]hydrazinyl]-5-nitrophenyl]sulfonylamino]benzoic acid |
| SMILES | COC(=O)c1ccc(/C=N\Nc2ccc([N+](=O)[O-])cc2S(=O)(=O)Nc2ccccc2C(=O)O)cc1 |
| InChI | InChI=1S/C22H18N4O8S/c1-34-22(29)15-8-6-14(7-9-15)13-23-24-19-11-10-16(26(30)31)12-20(19)35(32,33)25-18-5-3-2-4-17(18)21(27)28/h2-13,24-25H,1H3,(H,27,28)/b23-13- |
| InChIKey | DGLCMLDWXOZDEA-QRVIBDJDSA-N |
| XLogP | 3.33 |
| TPSA | 177.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.47 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|