C22H21N5O6S — CID 6511098
N-[4-[(Z)-[[2-[(2-methoxyphenyl)sulfamoyl]-4-nitrophenyl]hydrazinylidene]methyl]phenyl]acetamide (PubChem CID 6511098) has the molecular formula C22H21N5O6S and a molecular weight of 483.51 g/mol. Its IUPAC name is N-[4-[(Z)-[[2-[(2-methoxyphenyl)sulfamoyl]-4-nitrophenyl]hydrazinylidene]methyl]phenyl]acetamide.
| Compound Name | N-[4-[(Z)-[[2-[(2-methoxyphenyl)sulfamoyl]-4-nitrophenyl]hydrazinylidene]methyl]phenyl]acetamide |
|---|---|
| PubChem CID | 6511098 |
| Molecular Formula | C22H21N5O6S |
| Molecular Weight | 483.51 g/mol |
| Exact Mass | 483.12 |
| IUPAC Name | N-[4-[(Z)-[[2-[(2-methoxyphenyl)sulfamoyl]-4-nitrophenyl]hydrazinylidene]methyl]phenyl]acetamide |
| SMILES | COc1ccccc1NS(=O)(=O)c1cc([N+](=O)[O-])ccc1N/N=C\c1ccc(NC(C)=O)cc1 |
| InChI | InChI=1S/C22H21N5O6S/c1-15(28)24-17-9-7-16(8-10-17)14-23-25-20-12-11-18(27(29)30)13-22(20)34(31,32)26-19-5-3-4-6-21(19)33-2/h3-14,25-26H,1-2H3,(H,24,28)/b23-14- |
| InChIKey | GRAWDGVUJOCYHG-UCQKPKSFSA-N |
| XLogP | 3.81 |
| TPSA | 152.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.51 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|