C29H26N4O8S — CID 6115600
methyl 4-[[2-[(Z)-[[2-[(2-methoxyphenyl)sulfamoyl]-4-nitrophenyl]hydrazinylidene]methyl]phenoxy]methyl]benzoate (PubChem CID 6115600) has the molecular formula C29H26N4O8S and a molecular weight of 590.61 g/mol. Its IUPAC name is methyl 4-[[2-[(Z)-[[2-[(2-methoxyphenyl)sulfamoyl]-4-nitrophenyl]hydrazinylidene]methyl]phenoxy]methyl]benzoate.
| Compound Name | methyl 4-[[2-[(Z)-[[2-[(2-methoxyphenyl)sulfamoyl]-4-nitrophenyl]hydrazinylidene]methyl]phenoxy]methyl]benzoate |
|---|---|
| PubChem CID | 6115600 |
| Molecular Formula | C29H26N4O8S |
| Molecular Weight | 590.61 g/mol |
| Exact Mass | 590.15 |
| IUPAC Name | methyl 4-[[2-[(Z)-[[2-[(2-methoxyphenyl)sulfamoyl]-4-nitrophenyl]hydrazinylidene]methyl]phenoxy]methyl]benzoate |
| SMILES | COC(=O)c1ccc(COc2ccccc2/C=N\Nc2ccc([N+](=O)[O-])cc2S(=O)(=O)Nc2ccccc2OC)cc1 |
| InChI | InChI=1S/C29H26N4O8S/c1-39-27-10-6-4-8-24(27)32-42(37,38)28-17-23(33(35)36)15-16-25(28)31-30-18-22-7-3-5-9-26(22)41-19-20-11-13-21(14-12-20)29(34)40-2/h3-18,31-32H,19H2,1-2H3/b30-18- |
| InChIKey | KLZVVCHZLTXUHE-YKQZZPSBSA-N |
| XLogP | 5.22 |
| TPSA | 158.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.61 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|