C19H19N5O5S — CID 42995019
N-(2-methoxyphenyl)-2-[(2E)-2-[(1-methylpyrrol-2-yl)methylidene]hydrazinyl]-5-nitrobenzenesulfonamide (PubChem CID 42995019) has the molecular formula C19H19N5O5S and a molecular weight of 429.46 g/mol. Its IUPAC name is N-(2-methoxyphenyl)-2-[(2E)-2-[(1-methylpyrrol-2-yl)methylidene]hydrazinyl]-5-nitrobenzenesulfonamide.
| Compound Name | N-(2-methoxyphenyl)-2-[(2E)-2-[(1-methylpyrrol-2-yl)methylidene]hydrazinyl]-5-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 42995019 |
| Molecular Formula | C19H19N5O5S |
| Molecular Weight | 429.46 g/mol |
| Exact Mass | 429.11 |
| IUPAC Name | N-(2-methoxyphenyl)-2-[(2E)-2-[(1-methylpyrrol-2-yl)methylidene]hydrazinyl]-5-nitrobenzenesulfonamide |
| SMILES | COc1ccccc1NS(=O)(=O)c1cc([N+](=O)[O-])ccc1N/N=C/c1cccn1C |
| InChI | InChI=1S/C19H19N5O5S/c1-23-11-5-6-15(23)13-20-21-17-10-9-14(24(25)26)12-19(17)30(27,28)22-16-7-3-4-8-18(16)29-2/h3-13,21-22H,1-2H3/b20-13+ |
| InChIKey | QUSILJCDEFZVBZ-DEDYPNTBSA-N |
| XLogP | 3.19 |
| TPSA | 127.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.46 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hzone_pyrrol(64)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|