C19H14ClN5O6S — CID 4653257
N-(2-chlorophenyl)-5-nitro-2-[2-[(4-nitrophenyl)methylidene]hydrazinyl]benzenesulfonamide (PubChem CID 4653257) has the molecular formula C19H14ClN5O6S and a molecular weight of 475.87 g/mol. Its IUPAC name is N-(2-chlorophenyl)-5-nitro-2-[2-[(4-nitrophenyl)methylidene]hydrazinyl]benzenesulfonamide.
| Compound Name | N-(2-chlorophenyl)-5-nitro-2-[2-[(4-nitrophenyl)methylidene]hydrazinyl]benzenesulfonamide |
|---|---|
| PubChem CID | 4653257 |
| Molecular Formula | C19H14ClN5O6S |
| Molecular Weight | 475.87 g/mol |
| Exact Mass | 475.04 |
| IUPAC Name | N-(2-chlorophenyl)-5-nitro-2-[2-[(4-nitrophenyl)methylidene]hydrazinyl]benzenesulfonamide |
| SMILES | O=[N+]([O-])c1ccc(C=NNc2ccc([N+](=O)[O-])cc2S(=O)(=O)Nc2ccccc2Cl)cc1 |
| InChI | InChI=1S/C19H14ClN5O6S/c20-16-3-1-2-4-17(16)23-32(30,31)19-11-15(25(28)29)9-10-18(19)22-21-12-13-5-7-14(8-6-13)24(26)27/h1-12,22-23H |
| InChIKey | DFDJMYPVVKWSKA-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 156.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.87 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|