C16H17ClN4O4S — CID 3893128
2-(2-butan-2-ylidenehydrazinyl)-N-(2-chlorophenyl)-5-nitrobenzenesulfonamide (PubChem CID 3893128) has the molecular formula C16H17ClN4O4S and a molecular weight of 396.86 g/mol. Its IUPAC name is 2-(2-butan-2-ylidenehydrazinyl)-N-(2-chlorophenyl)-5-nitrobenzenesulfonamide.
| Compound Name | 2-(2-butan-2-ylidenehydrazinyl)-N-(2-chlorophenyl)-5-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 3893128 |
| Molecular Formula | C16H17ClN4O4S |
| Molecular Weight | 396.86 g/mol |
| Exact Mass | 396.07 |
| IUPAC Name | 2-(2-butan-2-ylidenehydrazinyl)-N-(2-chlorophenyl)-5-nitrobenzenesulfonamide |
| SMILES | CCC(C)=NNc1ccc([N+](=O)[O-])cc1S(=O)(=O)Nc1ccccc1Cl |
| InChI | InChI=1S/C16H17ClN4O4S/c1-3-11(2)18-19-15-9-8-12(21(22)23)10-16(15)26(24,25)20-14-7-5-4-6-13(14)17/h4-10,19-20H,3H2,1-2H3 |
| InChIKey | AVDINEVWZALVEB-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 113.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.86 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|