C19H21ClN4O4S — CID 18271748
N-(2-chlorophenyl)-2-[2-(4-methylcyclohexylidene)hydrazinyl]-5-nitrobenzenesulfonamide (PubChem CID 18271748) has the molecular formula C19H21ClN4O4S and a molecular weight of 436.92 g/mol. Its IUPAC name is N-(2-chlorophenyl)-2-[2-(4-methylcyclohexylidene)hydrazinyl]-5-nitrobenzenesulfonamide.
| Compound Name | N-(2-chlorophenyl)-2-[2-(4-methylcyclohexylidene)hydrazinyl]-5-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 18271748 |
| Molecular Formula | C19H21ClN4O4S |
| Molecular Weight | 436.92 g/mol |
| Exact Mass | 436.10 |
| IUPAC Name | N-(2-chlorophenyl)-2-[2-(4-methylcyclohexylidene)hydrazinyl]-5-nitrobenzenesulfonamide |
| SMILES | CC1CCC(=NNc2ccc([N+](=O)[O-])cc2S(=O)(=O)Nc2ccccc2Cl)CC1 |
| InChI | InChI=1S/C19H21ClN4O4S/c1-13-6-8-14(9-7-13)21-22-18-11-10-15(24(25)26)12-19(18)29(27,28)23-17-5-3-2-4-16(17)20/h2-5,10-13,22-23H,6-9H2,1H3/b21-14- |
| InChIKey | NYSVZADAXJBYOH-STZFKDTASA-N |
| XLogP | 5.03 |
| TPSA | 113.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.92 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|