C27H24N4O6S — CID 3373786
N-(2-methoxyphenyl)-5-nitro-2-[2-[(3-phenylmethoxyphenyl)methylidene]hydrazinyl]benzenesulfonamide (PubChem CID 3373786) has the molecular formula C27H24N4O6S and a molecular weight of 532.58 g/mol. Its IUPAC name is N-(2-methoxyphenyl)-5-nitro-2-[2-[(3-phenylmethoxyphenyl)methylidene]hydrazinyl]benzenesulfonamide.
| Compound Name | N-(2-methoxyphenyl)-5-nitro-2-[2-[(3-phenylmethoxyphenyl)methylidene]hydrazinyl]benzenesulfonamide |
|---|---|
| PubChem CID | 3373786 |
| Molecular Formula | C27H24N4O6S |
| Molecular Weight | 532.58 g/mol |
| Exact Mass | 532.14 |
| IUPAC Name | N-(2-methoxyphenyl)-5-nitro-2-[2-[(3-phenylmethoxyphenyl)methylidene]hydrazinyl]benzenesulfonamide |
| SMILES | COc1ccccc1NS(=O)(=O)c1cc([N+](=O)[O-])ccc1NN=Cc1cccc(OCc2ccccc2)c1 |
| InChI | InChI=1S/C27H24N4O6S/c1-36-26-13-6-5-12-24(26)30-38(34,35)27-17-22(31(32)33)14-15-25(27)29-28-18-21-10-7-11-23(16-21)37-19-20-8-3-2-4-9-20/h2-18,29-30H,19H2,1H3 |
| InChIKey | KFOVZGZIIDLLND-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 132.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.58 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|