C20H17ClN4O6S — CID 135874288
N-(4-chlorophenyl)-2-[(2Z)-2-[(4-hydroxy-3-methoxyphenyl)methylidene]hydrazinyl]-5-nitrobenzenesulfonamide (PubChem CID 135874288) has the molecular formula C20H17ClN4O6S and a molecular weight of 476.90 g/mol. Its IUPAC name is N-(4-chlorophenyl)-2-[(2Z)-2-[(4-hydroxy-3-methoxyphenyl)methylidene]hydrazinyl]-5-nitrobenzenesulfonamide.
| Compound Name | N-(4-chlorophenyl)-2-[(2Z)-2-[(4-hydroxy-3-methoxyphenyl)methylidene]hydrazinyl]-5-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 135874288 |
| Molecular Formula | C20H17ClN4O6S |
| Molecular Weight | 476.90 g/mol |
| Exact Mass | 476.06 |
| IUPAC Name | N-(4-chlorophenyl)-2-[(2Z)-2-[(4-hydroxy-3-methoxyphenyl)methylidene]hydrazinyl]-5-nitrobenzenesulfonamide |
| SMILES | COc1cc(/C=N\Nc2ccc([N+](=O)[O-])cc2S(=O)(=O)Nc2ccc(Cl)cc2)ccc1O |
| InChI | InChI=1S/C20H17ClN4O6S/c1-31-19-10-13(2-9-18(19)26)12-22-23-17-8-7-16(25(27)28)11-20(17)32(29,30)24-15-5-3-14(21)4-6-15/h2-12,23-24,26H,1H3/b22-12- |
| InChIKey | ZTKXHXIGWSXECA-UUYOSTAYSA-N |
| XLogP | 4.21 |
| TPSA | 143.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.90 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|