C23H23N5O7S — CID 6279634
2-[[2-[(2E)-2-[[4-[2-hydroxyethyl(methyl)amino]phenyl]methylidene]hydrazinyl]-5-nitrophenyl]sulfonylamino]benzoic acid (PubChem CID 6279634) has the molecular formula C23H23N5O7S and a molecular weight of 513.53 g/mol. Its IUPAC name is 2-[[2-[(2E)-2-[[4-[2-hydroxyethyl(methyl)amino]phenyl]methylidene]hydrazinyl]-5-nitrophenyl]sulfonylamino]benzoic acid.
| Compound Name | 2-[[2-[(2E)-2-[[4-[2-hydroxyethyl(methyl)amino]phenyl]methylidene]hydrazinyl]-5-nitrophenyl]sulfonylamino]benzoic acid |
|---|---|
| PubChem CID | 6279634 |
| Molecular Formula | C23H23N5O7S |
| Molecular Weight | 513.53 g/mol |
| Exact Mass | 513.13 |
| IUPAC Name | 2-[[2-[(2E)-2-[[4-[2-hydroxyethyl(methyl)amino]phenyl]methylidene]hydrazinyl]-5-nitrophenyl]sulfonylamino]benzoic acid |
| SMILES | CN(CCO)c1ccc(/C=N/Nc2ccc([N+](=O)[O-])cc2S(=O)(=O)Nc2ccccc2C(=O)O)cc1 |
| InChI | InChI=1S/C23H23N5O7S/c1-27(12-13-29)17-8-6-16(7-9-17)15-24-25-21-11-10-18(28(32)33)14-22(21)36(34,35)26-20-5-3-2-4-19(20)23(30)31/h2-11,14-15,25-26,29H,12-13H2,1H3,(H,30,31)/b24-15+ |
| InChIKey | JLJROIXJDZGXLO-BUVRLJJBSA-N |
| XLogP | 2.97 |
| TPSA | 174.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.53 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|