C33H29N5O4S — CID 6006499
N-(2,4-dimethylphenyl)-5-nitro-2-[(2Z)-2-[[4-(N-phenylanilino)phenyl]methylidene]hydrazinyl]benzenesulfonamide (PubChem CID 6006499) has the molecular formula C33H29N5O4S and a molecular weight of 591.69 g/mol. Its IUPAC name is N-(2,4-dimethylphenyl)-5-nitro-2-[(2Z)-2-[[4-(N-phenylanilino)phenyl]methylidene]hydrazinyl]benzenesulfonamide.
| Compound Name | N-(2,4-dimethylphenyl)-5-nitro-2-[(2Z)-2-[[4-(N-phenylanilino)phenyl]methylidene]hydrazinyl]benzenesulfonamide |
|---|---|
| PubChem CID | 6006499 |
| Molecular Formula | C33H29N5O4S |
| Molecular Weight | 591.69 g/mol |
| Exact Mass | 591.19 |
| IUPAC Name | N-(2,4-dimethylphenyl)-5-nitro-2-[(2Z)-2-[[4-(N-phenylanilino)phenyl]methylidene]hydrazinyl]benzenesulfonamide |
| SMILES | Cc1ccc(NS(=O)(=O)c2cc([N+](=O)[O-])ccc2N/N=C\c2ccc(N(c3ccccc3)c3ccccc3)cc2)c(C)c1 |
| InChI | InChI=1S/C33H29N5O4S/c1-24-13-19-31(25(2)21-24)36-43(41,42)33-22-30(38(39)40)18-20-32(33)35-34-23-26-14-16-29(17-15-26)37(27-9-5-3-6-10-27)28-11-7-4-8-12-28/h3-23,35-36H,1-2H3/b34-23- |
| InChIKey | XWCGUMKLFJLFSM-XSVYLIDLSA-N |
| XLogP | 7.93 |
| TPSA | 116.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.69 |
| LogP ≤ 5 | 7.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|