C22H20F2N4O5S — CID 6303211
2-[(2Z)-2-[[4-(difluoromethoxy)phenyl]methylidene]hydrazinyl]-N-(2,4-dimethylphenyl)-5-nitrobenzenesulfonamide (PubChem CID 6303211) has the molecular formula C22H20F2N4O5S and a molecular weight of 490.49 g/mol. Its IUPAC name is 2-[(2Z)-2-[[4-(difluoromethoxy)phenyl]methylidene]hydrazinyl]-N-(2,4-dimethylphenyl)-5-nitrobenzenesulfonamide.
| Compound Name | 2-[(2Z)-2-[[4-(difluoromethoxy)phenyl]methylidene]hydrazinyl]-N-(2,4-dimethylphenyl)-5-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 6303211 |
| Molecular Formula | C22H20F2N4O5S |
| Molecular Weight | 490.49 g/mol |
| Exact Mass | 490.11 |
| IUPAC Name | 2-[(2Z)-2-[[4-(difluoromethoxy)phenyl]methylidene]hydrazinyl]-N-(2,4-dimethylphenyl)-5-nitrobenzenesulfonamide |
| SMILES | Cc1ccc(NS(=O)(=O)c2cc([N+](=O)[O-])ccc2N/N=C\c2ccc(OC(F)F)cc2)c(C)c1 |
| InChI | InChI=1S/C22H20F2N4O5S/c1-14-3-9-19(15(2)11-14)27-34(31,32)21-12-17(28(29)30)6-10-20(21)26-25-13-16-4-7-18(8-5-16)33-22(23)24/h3-13,22,26-27H,1-2H3/b25-13- |
| InChIKey | FNMXZXUZWNOXNA-MXAYSNPKSA-N |
| XLogP | 5.06 |
| TPSA | 122.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.49 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|