C22H22N4O5S — CID 3394807
2-[2-[(2,5-dimethylphenyl)methylidene]hydrazinyl]-N-(4-methoxyphenyl)-5-nitrobenzenesulfonamide (PubChem CID 3394807) has the molecular formula C22H22N4O5S and a molecular weight of 454.51 g/mol. Its IUPAC name is 2-[2-[(2,5-dimethylphenyl)methylidene]hydrazinyl]-N-(4-methoxyphenyl)-5-nitrobenzenesulfonamide.
| Compound Name | 2-[2-[(2,5-dimethylphenyl)methylidene]hydrazinyl]-N-(4-methoxyphenyl)-5-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 3394807 |
| Molecular Formula | C22H22N4O5S |
| Molecular Weight | 454.51 g/mol |
| Exact Mass | 454.13 |
| IUPAC Name | 2-[2-[(2,5-dimethylphenyl)methylidene]hydrazinyl]-N-(4-methoxyphenyl)-5-nitrobenzenesulfonamide |
| SMILES | COc1ccc(NS(=O)(=O)c2cc([N+](=O)[O-])ccc2NN=Cc2cc(C)ccc2C)cc1 |
| InChI | InChI=1S/C22H22N4O5S/c1-15-4-5-16(2)17(12-15)14-23-24-21-11-8-19(26(27)28)13-22(21)32(29,30)25-18-6-9-20(31-3)10-7-18/h4-14,24-25H,1-3H3 |
| InChIKey | FXOLIDQSAMUJEF-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 122.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.51 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|