C31H27N5O7S — CID 135608128
2-[(2E)-2-[[2-(2,4-dimethylphenyl)-3-hydroxy-1-oxoisoquinolin-4-yl]methylidene]hydrazinyl]-N-(4-methoxyphenyl)-5-nitrobenzenesulfonamide (PubChem CID 135608128) has the molecular formula C31H27N5O7S and a molecular weight of 613.65 g/mol. Its IUPAC name is 2-[(2E)-2-[[2-(2,4-dimethylphenyl)-3-hydroxy-1-oxoisoquinolin-4-yl]methylidene]hydrazinyl]-N-(4-methoxyphenyl)-5-nitrobenzenesulfonamide.
| Compound Name | 2-[(2E)-2-[[2-(2,4-dimethylphenyl)-3-hydroxy-1-oxoisoquinolin-4-yl]methylidene]hydrazinyl]-N-(4-methoxyphenyl)-5-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 135608128 |
| Molecular Formula | C31H27N5O7S |
| Molecular Weight | 613.65 g/mol |
| Exact Mass | 613.16 |
| IUPAC Name | 2-[(2E)-2-[[2-(2,4-dimethylphenyl)-3-hydroxy-1-oxoisoquinolin-4-yl]methylidene]hydrazinyl]-N-(4-methoxyphenyl)-5-nitrobenzenesulfonamide |
| SMILES | COc1ccc(NS(=O)(=O)c2cc([N+](=O)[O-])ccc2N/N=C/c2c(O)n(-c3ccc(C)cc3C)c(=O)c3ccccc23)cc1 |
| InChI | InChI=1S/C31H27N5O7S/c1-19-8-15-28(20(2)16-19)35-30(37)25-7-5-4-6-24(25)26(31(35)38)18-32-33-27-14-11-22(36(39)40)17-29(27)44(41,42)34-21-9-12-23(43-3)13-10-21/h4-18,33-34,38H,1-3H3/b32-18+ |
| InChIKey | MNTUPCYRDBWFQC-KCSSXMTESA-N |
| XLogP | 5.48 |
| TPSA | 165.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.65 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|