C30H24ClN5O6S — CID 137227734
N-(4-chlorophenyl)-4-[(2Z)-2-[[2-(2,4-dimethylphenyl)-3-hydroxy-1-oxoisoquinolin-4-yl]methylidene]hydrazinyl]-3-nitrobenzenesulfonamide (PubChem CID 137227734) has the molecular formula C30H24ClN5O6S and a molecular weight of 618.07 g/mol. Its IUPAC name is N-(4-chlorophenyl)-4-[(2Z)-2-[[2-(2,4-dimethylphenyl)-3-hydroxy-1-oxoisoquinolin-4-yl]methylidene]hydrazinyl]-3-nitrobenzenesulfonamide.
| Compound Name | N-(4-chlorophenyl)-4-[(2Z)-2-[[2-(2,4-dimethylphenyl)-3-hydroxy-1-oxoisoquinolin-4-yl]methylidene]hydrazinyl]-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 137227734 |
| Molecular Formula | C30H24ClN5O6S |
| Molecular Weight | 618.07 g/mol |
| Exact Mass | 617.11 |
| IUPAC Name | N-(4-chlorophenyl)-4-[(2Z)-2-[[2-(2,4-dimethylphenyl)-3-hydroxy-1-oxoisoquinolin-4-yl]methylidene]hydrazinyl]-3-nitrobenzenesulfonamide |
| SMILES | Cc1ccc(-n2c(O)c(/C=N\Nc3ccc(S(=O)(=O)Nc4ccc(Cl)cc4)cc3[N+](=O)[O-])c3ccccc3c2=O)c(C)c1 |
| InChI | InChI=1S/C30H24ClN5O6S/c1-18-7-14-27(19(2)15-18)35-29(37)24-6-4-3-5-23(24)25(30(35)38)17-32-33-26-13-12-22(16-28(26)36(39)40)43(41,42)34-21-10-8-20(31)9-11-21/h3-17,33-34,38H,1-2H3/b32-17- |
| InChIKey | WYXWSHUTAJDGHH-KYHGBAKBSA-N |
| XLogP | 6.12 |
| TPSA | 155.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.07 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|