C20H18ClN5O6S — CID 135614401
N-(4-chlorophenyl)-4-[(2E)-2-[[3-hydroxy-5-(hydroxymethyl)-2-methyl-4-pyridinyl]methylidene]hydrazinyl]-3-nitrobenzenesulfonamide (PubChem CID 135614401) has the molecular formula C20H18ClN5O6S and a molecular weight of 491.91 g/mol. Its IUPAC name is N-(4-chlorophenyl)-4-[(2E)-2-[[3-hydroxy-5-(hydroxymethyl)-2-methyl-4-pyridinyl]methylidene]hydrazinyl]-3-nitrobenzenesulfonamide.
| Compound Name | N-(4-chlorophenyl)-4-[(2E)-2-[[3-hydroxy-5-(hydroxymethyl)-2-methyl-4-pyridinyl]methylidene]hydrazinyl]-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 135614401 |
| Molecular Formula | C20H18ClN5O6S |
| Molecular Weight | 491.91 g/mol |
| Exact Mass | 491.07 |
| IUPAC Name | N-(4-chlorophenyl)-4-[(2E)-2-[[3-hydroxy-5-(hydroxymethyl)-2-methyl-4-pyridinyl]methylidene]hydrazinyl]-3-nitrobenzenesulfonamide |
| SMILES | Cc1ncc(CO)c(/C=N/Nc2ccc(S(=O)(=O)Nc3ccc(Cl)cc3)cc2[N+](=O)[O-])c1O |
| InChI | InChI=1S/C20H18ClN5O6S/c1-12-20(28)17(13(11-27)9-22-12)10-23-24-18-7-6-16(8-19(18)26(29)30)33(31,32)25-15-4-2-14(21)3-5-15/h2-10,24-25,27-28H,11H2,1H3/b23-10+ |
| InChIKey | PCUVDBISTCLDSF-AUEPDCJTSA-N |
| XLogP | 3.40 |
| TPSA | 167.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.91 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|