C23H24ClN5O5S — CID 135679343
N-(4-chlorophenyl)-4-[(2E)-2-[[4-(diethylamino)-2-hydroxyphenyl]methylidene]hydrazinyl]-3-nitrobenzenesulfonamide (PubChem CID 135679343) has the molecular formula C23H24ClN5O5S and a molecular weight of 518.00 g/mol. Its IUPAC name is N-(4-chlorophenyl)-4-[(2E)-2-[[4-(diethylamino)-2-hydroxyphenyl]methylidene]hydrazinyl]-3-nitrobenzenesulfonamide.
| Compound Name | N-(4-chlorophenyl)-4-[(2E)-2-[[4-(diethylamino)-2-hydroxyphenyl]methylidene]hydrazinyl]-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 135679343 |
| Molecular Formula | C23H24ClN5O5S |
| Molecular Weight | 518.00 g/mol |
| Exact Mass | 517.12 |
| IUPAC Name | N-(4-chlorophenyl)-4-[(2E)-2-[[4-(diethylamino)-2-hydroxyphenyl]methylidene]hydrazinyl]-3-nitrobenzenesulfonamide |
| SMILES | CCN(CC)c1ccc(/C=N/Nc2ccc(S(=O)(=O)Nc3ccc(Cl)cc3)cc2[N+](=O)[O-])c(O)c1 |
| InChI | InChI=1S/C23H24ClN5O5S/c1-3-28(4-2)19-10-5-16(23(30)13-19)15-25-26-21-12-11-20(14-22(21)29(31)32)35(33,34)27-18-8-6-17(24)7-9-18/h5-15,26-27,30H,3-4H2,1-2H3/b25-15+ |
| InChIKey | VVHLVOWKTCMEJF-MFKUBSTISA-N |
| XLogP | 5.05 |
| TPSA | 137.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.00 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|