C21H29N5O5S — CID 3354356
4-[2-[[4-(diethylamino)-2-hydroxyphenyl]methylidene]hydrazinyl]-N,N-diethyl-3-nitrobenzenesulfonamide (PubChem CID 3354356) has the molecular formula C21H29N5O5S and a molecular weight of 463.56 g/mol. Its IUPAC name is 4-[2-[[4-(diethylamino)-2-hydroxyphenyl]methylidene]hydrazinyl]-N,N-diethyl-3-nitrobenzenesulfonamide.
| Compound Name | 4-[2-[[4-(diethylamino)-2-hydroxyphenyl]methylidene]hydrazinyl]-N,N-diethyl-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 3354356 |
| Molecular Formula | C21H29N5O5S |
| Molecular Weight | 463.56 g/mol |
| Exact Mass | 463.19 |
| IUPAC Name | 4-[2-[[4-(diethylamino)-2-hydroxyphenyl]methylidene]hydrazinyl]-N,N-diethyl-3-nitrobenzenesulfonamide |
| SMILES | CCN(CC)c1ccc(C=NNc2ccc(S(=O)(=O)N(CC)CC)cc2[N+](=O)[O-])c(O)c1 |
| InChI | InChI=1S/C21H29N5O5S/c1-5-24(6-2)17-10-9-16(21(27)13-17)15-22-23-19-12-11-18(14-20(19)26(28)29)32(30,31)25(7-3)8-4/h9-15,23,27H,5-8H2,1-4H3 |
| InChIKey | JVIIJRVKTBGUJL-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 128.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.56 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|