C17H18Br2N4O5S — CID 4159654
4-[2-[(3,5-dibromo-2-hydroxyphenyl)methylidene]hydrazinyl]-N,N-diethyl-3-nitrobenzenesulfonamide (PubChem CID 4159654) has the molecular formula C17H18Br2N4O5S and a molecular weight of 550.23 g/mol. Its IUPAC name is 4-[2-[(3,5-dibromo-2-hydroxyphenyl)methylidene]hydrazinyl]-N,N-diethyl-3-nitrobenzenesulfonamide.
| Compound Name | 4-[2-[(3,5-dibromo-2-hydroxyphenyl)methylidene]hydrazinyl]-N,N-diethyl-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 4159654 |
| Molecular Formula | C17H18Br2N4O5S |
| Molecular Weight | 550.23 g/mol |
| Exact Mass | 547.94 |
| IUPAC Name | 4-[2-[(3,5-dibromo-2-hydroxyphenyl)methylidene]hydrazinyl]-N,N-diethyl-3-nitrobenzenesulfonamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(NN=Cc2cc(Br)cc(Br)c2O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C17H18Br2N4O5S/c1-3-22(4-2)29(27,28)13-5-6-15(16(9-13)23(25)26)21-20-10-11-7-12(18)8-14(19)17(11)24/h5-10,21,24H,3-4H2,1-2H3 |
| InChIKey | VDVHIDOSNYVGHB-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 125.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.23 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|