C18H20N4O6S — CID 4223142
4-[[[4-(diethylsulfamoyl)-2-nitrophenyl]hydrazinylidene]methyl]benzoic acid (PubChem CID 4223142) has the molecular formula C18H20N4O6S and a molecular weight of 420.45 g/mol. Its IUPAC name is 4-[[[4-(diethylsulfamoyl)-2-nitrophenyl]hydrazinylidene]methyl]benzoic acid.
| Compound Name | 4-[[[4-(diethylsulfamoyl)-2-nitrophenyl]hydrazinylidene]methyl]benzoic acid |
|---|---|
| PubChem CID | 4223142 |
| Molecular Formula | C18H20N4O6S |
| Molecular Weight | 420.45 g/mol |
| Exact Mass | 420.11 |
| IUPAC Name | 4-[[[4-(diethylsulfamoyl)-2-nitrophenyl]hydrazinylidene]methyl]benzoic acid |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(NN=Cc2ccc(C(=O)O)cc2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H20N4O6S/c1-3-21(4-2)29(27,28)15-9-10-16(17(11-15)22(25)26)20-19-12-13-5-7-14(8-6-13)18(23)24/h5-12,20H,3-4H2,1-2H3,(H,23,24) |
| InChIKey | ZLVKOUORLNYEHN-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 142.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.45 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|