C20H24N4O4S — CID 6141921
N,N-diethyl-4-[(2Z)-2-[(E)-2-methyl-3-phenylprop-2-enylidene]hydrazinyl]-3-nitrobenzenesulfonamide (PubChem CID 6141921) has the molecular formula C20H24N4O4S and a molecular weight of 416.50 g/mol. Its IUPAC name is N,N-diethyl-4-[(2Z)-2-[(E)-2-methyl-3-phenylprop-2-enylidene]hydrazinyl]-3-nitrobenzenesulfonamide.
| Compound Name | N,N-diethyl-4-[(2Z)-2-[(E)-2-methyl-3-phenylprop-2-enylidene]hydrazinyl]-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 6141921 |
| Molecular Formula | C20H24N4O4S |
| Molecular Weight | 416.50 g/mol |
| Exact Mass | 416.15 |
| IUPAC Name | N,N-diethyl-4-[(2Z)-2-[(E)-2-methyl-3-phenylprop-2-enylidene]hydrazinyl]-3-nitrobenzenesulfonamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(N/N=C\C(C)=C\c2ccccc2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C20H24N4O4S/c1-4-23(5-2)29(27,28)18-11-12-19(20(14-18)24(25)26)22-21-15-16(3)13-17-9-7-6-8-10-17/h6-15,22H,4-5H2,1-3H3/b16-13+,21-15- |
| InChIKey | XRVPNVYZSALNFC-WLWZMOCUSA-N |
| XLogP | 4.13 |
| TPSA | 104.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.50 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|