C24H32N4O4S — CID 5025810
4-[2-(2-benzylideneheptylidene)hydrazinyl]-N,N-diethyl-3-nitrobenzenesulfonamide (PubChem CID 5025810) has the molecular formula C24H32N4O4S and a molecular weight of 472.61 g/mol. Its IUPAC name is 4-[2-(2-benzylideneheptylidene)hydrazinyl]-N,N-diethyl-3-nitrobenzenesulfonamide.
| Compound Name | 4-[2-(2-benzylideneheptylidene)hydrazinyl]-N,N-diethyl-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 5025810 |
| Molecular Formula | C24H32N4O4S |
| Molecular Weight | 472.61 g/mol |
| Exact Mass | 472.21 |
| IUPAC Name | 4-[2-(2-benzylideneheptylidene)hydrazinyl]-N,N-diethyl-3-nitrobenzenesulfonamide |
| SMILES | CCCCCC(C=NNc1ccc(S(=O)(=O)N(CC)CC)cc1[N+](=O)[O-])=Cc1ccccc1 |
| InChI | InChI=1S/C24H32N4O4S/c1-4-7-9-14-21(17-20-12-10-8-11-13-20)19-25-26-23-16-15-22(18-24(23)28(29)30)33(31,32)27(5-2)6-3/h8,10-13,15-19,26H,4-7,9,14H2,1-3H3 |
| InChIKey | ALJPPTNHTLCZPK-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 104.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.61 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|