C17H19FN4O4S — CID 6160791
N,N-diethyl-4-[(2Z)-2-[(3-fluorophenyl)methylidene]hydrazinyl]-3-nitrobenzenesulfonamide (PubChem CID 6160791) has the molecular formula C17H19FN4O4S and a molecular weight of 394.43 g/mol. Its IUPAC name is N,N-diethyl-4-[(2Z)-2-[(3-fluorophenyl)methylidene]hydrazinyl]-3-nitrobenzenesulfonamide.
| Compound Name | N,N-diethyl-4-[(2Z)-2-[(3-fluorophenyl)methylidene]hydrazinyl]-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 6160791 |
| Molecular Formula | C17H19FN4O4S |
| Molecular Weight | 394.43 g/mol |
| Exact Mass | 394.11 |
| IUPAC Name | N,N-diethyl-4-[(2Z)-2-[(3-fluorophenyl)methylidene]hydrazinyl]-3-nitrobenzenesulfonamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(N/N=C\c2cccc(F)c2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C17H19FN4O4S/c1-3-21(4-2)27(25,26)15-8-9-16(17(11-15)22(23)24)20-19-12-13-6-5-7-14(18)10-13/h5-12,20H,3-4H2,1-2H3/b19-12- |
| InChIKey | JMQFNBRTZQANEN-UNOMPAQXSA-N |
| XLogP | 3.21 |
| TPSA | 104.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.43 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|