C20H26N4O7S — CID 6076366
N,N-diethyl-3-nitro-4-[(2Z)-2-[(2,4,5-trimethoxyphenyl)methylidene]hydrazinyl]benzenesulfonamide (PubChem CID 6076366) has the molecular formula C20H26N4O7S and a molecular weight of 466.52 g/mol. Its IUPAC name is N,N-diethyl-3-nitro-4-[(2Z)-2-[(2,4,5-trimethoxyphenyl)methylidene]hydrazinyl]benzenesulfonamide.
| Compound Name | N,N-diethyl-3-nitro-4-[(2Z)-2-[(2,4,5-trimethoxyphenyl)methylidene]hydrazinyl]benzenesulfonamide |
|---|---|
| PubChem CID | 6076366 |
| Molecular Formula | C20H26N4O7S |
| Molecular Weight | 466.52 g/mol |
| Exact Mass | 466.15 |
| IUPAC Name | N,N-diethyl-3-nitro-4-[(2Z)-2-[(2,4,5-trimethoxyphenyl)methylidene]hydrazinyl]benzenesulfonamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(N/N=C\c2cc(OC)c(OC)cc2OC)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C20H26N4O7S/c1-6-23(7-2)32(27,28)15-8-9-16(17(11-15)24(25)26)22-21-13-14-10-19(30-4)20(31-5)12-18(14)29-3/h8-13,22H,6-7H2,1-5H3/b21-13- |
| InChIKey | KIAZSJFKSMYFLQ-BKUYFWCQSA-N |
| XLogP | 3.10 |
| TPSA | 132.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.52 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|