C19H26N4O5S — CID 6255801
N,N-diethyl-6-[(2Z)-2-[(2,4,5-trimethoxyphenyl)methylidene]hydrazinyl]pyridine-3-sulfonamide (PubChem CID 6255801) has the molecular formula C19H26N4O5S and a molecular weight of 422.51 g/mol. Its IUPAC name is N,N-diethyl-6-[(2Z)-2-[(2,4,5-trimethoxyphenyl)methylidene]hydrazinyl]pyridine-3-sulfonamide.
| Compound Name | N,N-diethyl-6-[(2Z)-2-[(2,4,5-trimethoxyphenyl)methylidene]hydrazinyl]pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 6255801 |
| Molecular Formula | C19H26N4O5S |
| Molecular Weight | 422.51 g/mol |
| Exact Mass | 422.16 |
| IUPAC Name | N,N-diethyl-6-[(2Z)-2-[(2,4,5-trimethoxyphenyl)methylidene]hydrazinyl]pyridine-3-sulfonamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(N/N=C\c2cc(OC)c(OC)cc2OC)nc1 |
| InChI | InChI=1S/C19H26N4O5S/c1-6-23(7-2)29(24,25)15-8-9-19(20-13-15)22-21-12-14-10-17(27-4)18(28-5)11-16(14)26-3/h8-13H,6-7H2,1-5H3,(H,20,22)/b21-12- |
| InChIKey | AMQXJRUDTRZSGY-MTJSOVHGSA-N |
| XLogP | 2.58 |
| TPSA | 102.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.51 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|