C17H19F3N4O2S — CID 4539634
N,N-diethyl-6-[2-[[2-(trifluoromethyl)phenyl]methylidene]hydrazinyl]pyridine-3-sulfonamide (PubChem CID 4539634) has the molecular formula C17H19F3N4O2S and a molecular weight of 400.43 g/mol. Its IUPAC name is N,N-diethyl-6-[2-[[2-(trifluoromethyl)phenyl]methylidene]hydrazinyl]pyridine-3-sulfonamide.
| Compound Name | N,N-diethyl-6-[2-[[2-(trifluoromethyl)phenyl]methylidene]hydrazinyl]pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 4539634 |
| Molecular Formula | C17H19F3N4O2S |
| Molecular Weight | 400.43 g/mol |
| Exact Mass | 400.12 |
| IUPAC Name | N,N-diethyl-6-[2-[[2-(trifluoromethyl)phenyl]methylidene]hydrazinyl]pyridine-3-sulfonamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(NN=Cc2ccccc2C(F)(F)F)nc1 |
| InChI | InChI=1S/C17H19F3N4O2S/c1-3-24(4-2)27(25,26)14-9-10-16(21-12-14)23-22-11-13-7-5-6-8-15(13)17(18,19)20/h5-12H,3-4H2,1-2H3,(H,21,23) |
| InChIKey | RWSDBEUOHPCDOK-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 74.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.43 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|