C16H18Cl2N4O2S — CID 4849551
6-[2-[(2,3-dichlorophenyl)methylidene]hydrazinyl]-N,N-diethylpyridine-3-sulfonamide (PubChem CID 4849551) has the molecular formula C16H18Cl2N4O2S and a molecular weight of 401.32 g/mol. Its IUPAC name is 6-[2-[(2,3-dichlorophenyl)methylidene]hydrazinyl]-N,N-diethylpyridine-3-sulfonamide.
| Compound Name | 6-[2-[(2,3-dichlorophenyl)methylidene]hydrazinyl]-N,N-diethylpyridine-3-sulfonamide |
|---|---|
| PubChem CID | 4849551 |
| Molecular Formula | C16H18Cl2N4O2S |
| Molecular Weight | 401.32 g/mol |
| Exact Mass | 400.05 |
| IUPAC Name | 6-[2-[(2,3-dichlorophenyl)methylidene]hydrazinyl]-N,N-diethylpyridine-3-sulfonamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(NN=Cc2cccc(Cl)c2Cl)nc1 |
| InChI | InChI=1S/C16H18Cl2N4O2S/c1-3-22(4-2)25(23,24)13-8-9-15(19-11-13)21-20-10-12-6-5-7-14(17)16(12)18/h5-11H,3-4H2,1-2H3,(H,19,21) |
| InChIKey | SYHJBCIFIZJICK-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 74.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.32 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|